C12H16O2 — CID 14216292
8-methoxy-3,4-dimethyl-3,4-dihydro-1H-isochromene (PubChem CID 14216292) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 8-methoxy-3,4-dimethyl-3,4-dihydro-1H-isochromene.
| Compound Name | 8-methoxy-3,4-dimethyl-3,4-dihydro-1H-isochromene |
|---|---|
| PubChem CID | 14216292 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 8-methoxy-3,4-dimethyl-3,4-dihydro-1H-isochromene |
| SMILES | COc1cccc2c1COC(C)C2C |
| InChI | InChI=1S/C12H16O2/c1-8-9(2)14-7-11-10(8)5-4-6-12(11)13-3/h4-6,8-9H,7H2,1-3H3 |
| InChIKey | XUXPZZWXPUXWRL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |