C17H26N2 — CID 103980640
N-cycloheptyl-2,3,4,5-tetrahydro-1H-2-benzazepin-5-amine (PubChem CID 103980640) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is N-cycloheptyl-2,3,4,5-tetrahydro-1H-2-benzazepin-5-amine.
| Compound Name | N-cycloheptyl-2,3,4,5-tetrahydro-1H-2-benzazepin-5-amine |
|---|---|
| PubChem CID | 103980640 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | N-cycloheptyl-2,3,4,5-tetrahydro-1H-2-benzazepin-5-amine |
| SMILES | c1ccc2c(c1)CNCCC2NC1CCCCCC1 |
| InChI | InChI=1S/C17H26N2/c1-2-4-9-15(8-3-1)19-17-11-12-18-13-14-7-5-6-10-16(14)17/h5-7,10,15,17-19H,1-4,8-9,11-13H2 |
| InChIKey | DUODSDZCOBAYME-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |