C10H10BrNO2 — CID 174877397
2-(2,3-dihydro-1H-indol-3-yl)-2-oxoacetaldehyde;hydrobromide (PubChem CID 174877397) has the molecular formula C10H10BrNO2 and a molecular weight of 256.10 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-indol-3-yl)-2-oxoacetaldehyde;hydrobromide.
| Compound Name | 2-(2,3-dihydro-1H-indol-3-yl)-2-oxoacetaldehyde;hydrobromide |
|---|---|
| PubChem CID | 174877397 |
| Molecular Formula | C10H10BrNO2 |
| Molecular Weight | 256.10 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | 2-(2,3-dihydro-1H-indol-3-yl)-2-oxoacetaldehyde;hydrobromide |
| SMILES | Br.O=CC(=O)C1CNc2ccccc21 |
| InChI | InChI=1S/C10H9NO2.BrH/c12-6-10(13)8-5-11-9-4-2-1-3-7(8)9;/h1-4,6,8,11H,5H2;1H |
| InChIKey | OYPOTPGLCYEELJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.10 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|