C14H18FN — CID 106985949
7-fluoro-3-(2-methylcyclopentyl)-2,3-dihydro-1H-indole (PubChem CID 106985949) has the molecular formula C14H18FN and a molecular weight of 219.30 g/mol. Its IUPAC name is 7-fluoro-3-(2-methylcyclopentyl)-2,3-dihydro-1H-indole.
| Compound Name | 7-fluoro-3-(2-methylcyclopentyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 106985949 |
| Molecular Formula | C14H18FN |
| Molecular Weight | 219.30 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 7-fluoro-3-(2-methylcyclopentyl)-2,3-dihydro-1H-indole |
| SMILES | CC1CCCC1C1CNc2c(F)cccc21 |
| InChI | InChI=1S/C14H18FN/c1-9-4-2-5-10(9)12-8-16-14-11(12)6-3-7-13(14)15/h3,6-7,9-10,12,16H,2,4-5,8H2,1H3 |
| InChIKey | TVZRRIUYAZCQRW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.30 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |