C12H15FN2 — CID 83820061
6-fluoro-2-methyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole (PubChem CID 83820061) has the molecular formula C12H15FN2 and a molecular weight of 206.26 g/mol. Its IUPAC name is 6-fluoro-2-methyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole.
| Compound Name | 6-fluoro-2-methyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 83820061 |
| Molecular Formula | C12H15FN2 |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 6-fluoro-2-methyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole |
| SMILES | CN1CCC2Nc3c(F)cccc3C2C1 |
| InChI | InChI=1S/C12H15FN2/c1-15-6-5-11-9(7-15)8-3-2-4-10(13)12(8)14-11/h2-4,9,11,14H,5-7H2,1H3 |
| InChIKey | DXLFUOVOCVPAHV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |