C18H18Cl2N2S — CID 143131419
(4aS)-6-(2,5-dichlorophenyl)sulfanyl-2-methyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole (PubChem CID 143131419) has the molecular formula C18H18Cl2N2S and a molecular weight of 365.33 g/mol. Its IUPAC name is (4aS)-6-(2,5-dichlorophenyl)sulfanyl-2-methyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole.
| Compound Name | (4aS)-6-(2,5-dichlorophenyl)sulfanyl-2-methyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 143131419 |
| Molecular Formula | C18H18Cl2N2S |
| Molecular Weight | 365.33 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | (4aS)-6-(2,5-dichlorophenyl)sulfanyl-2-methyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole |
| SMILES | CN1CC[C@@H]2Nc3c(Sc4cc(Cl)ccc4Cl)cccc3C2C1 |
| InChI | InChI=1S/C18H18Cl2N2S/c1-22-8-7-15-13(10-22)12-3-2-4-16(18(12)21-15)23-17-9-11(19)5-6-14(17)20/h2-6,9,13,15,21H,7-8,10H2,1H3/t13?,15-/m0/s1 |
| InChIKey | WYQAOWOPMBONTM-WUJWULDRSA-N |
| XLogP | 5.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.33 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |