C12H15BrN2 — CID 83825912
8-bromo-2-methyl-1,3,4,4a,9,9a-hexahydropyrido[3,4-b]indole (PubChem CID 83825912) has the molecular formula C12H15BrN2 and a molecular weight of 267.17 g/mol. Its IUPAC name is 8-bromo-2-methyl-1,3,4,4a,9,9a-hexahydropyrido[3,4-b]indole.
| Compound Name | 8-bromo-2-methyl-1,3,4,4a,9,9a-hexahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 83825912 |
| Molecular Formula | C12H15BrN2 |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 8-bromo-2-methyl-1,3,4,4a,9,9a-hexahydropyrido[3,4-b]indole |
| SMILES | CN1CCC2c3cccc(Br)c3NC2C1 |
| InChI | InChI=1S/C12H15BrN2/c1-15-6-5-8-9-3-2-4-10(13)12(9)14-11(8)7-15/h2-4,8,11,14H,5-7H2,1H3 |
| InChIKey | GKNMBLCSPFSBLQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |