C22H25FN2OS — CID 76581919
1-(4-fluorophenyl)-4-(6-methylsulfanyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indol-2-yl)butan-1-one (PubChem CID 76581919) has the molecular formula C22H25FN2OS and a molecular weight of 384.52 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-(6-methylsulfanyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indol-2-yl)butan-1-one.
| Compound Name | 1-(4-fluorophenyl)-4-(6-methylsulfanyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indol-2-yl)butan-1-one |
|---|---|
| PubChem CID | 76581919 |
| Molecular Formula | C22H25FN2OS |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 1-(4-fluorophenyl)-4-(6-methylsulfanyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indol-2-yl)butan-1-one |
| SMILES | CSc1cccc2c1NC1CCN(CCCC(=O)c3ccc(F)cc3)CC21 |
| InChI | InChI=1S/C22H25FN2OS/c1-27-21-6-2-4-17-18-14-25(13-11-19(18)24-22(17)21)12-3-5-20(26)15-7-9-16(23)10-8-15/h2,4,6-10,18-19,24H,3,5,11-14H2,1H3 |
| InChIKey | SDLJNLZPJXTTTF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |