C25H29FN2O — CID 130184869
1-(4-fluorophenyl)-4-[(10R,15S)-4-methyl-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-trien-12-yl]butan-1-one (PubChem CID 130184869) has the molecular formula C25H29FN2O and a molecular weight of 392.52 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-[(10R,15S)-4-methyl-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-trien-12-yl]butan-1-one.
| Compound Name | 1-(4-fluorophenyl)-4-[(10R,15S)-4-methyl-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-trien-12-yl]butan-1-one |
|---|---|
| PubChem CID | 130184869 |
| Molecular Formula | C25H29FN2O |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 1-(4-fluorophenyl)-4-[(10R,15S)-4-methyl-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-trien-12-yl]butan-1-one |
| SMILES | CC1CCN2c3c1cccc3[C@@H]1CN(CCCC(=O)c3ccc(F)cc3)CC[C@@H]12 |
| InChI | InChI=1S/C25H29FN2O/c1-17-11-15-28-23-12-14-27(16-22(23)21-5-2-4-20(17)25(21)28)13-3-6-24(29)18-7-9-19(26)10-8-18/h2,4-5,7-10,17,22-23H,3,6,11-16H2,1H3/t17?,22-,23-/m0/s1 |
| InChIKey | LQXQRIJCKHNYDS-CNZKWUBKSA-N |
| XLogP | 4.97 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |