C25H30FN3O3 — CID 177041318
4-(4-ethyl-3,3-dihydroxy-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl)-1-(4-fluorophenyl)butan-1-one (PubChem CID 177041318) has the molecular formula C25H30FN3O3 and a molecular weight of 439.53 g/mol. Its IUPAC name is 4-(4-ethyl-3,3-dihydroxy-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl)-1-(4-fluorophenyl)butan-1-one.
| Compound Name | 4-(4-ethyl-3,3-dihydroxy-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl)-1-(4-fluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 177041318 |
| Molecular Formula | C25H30FN3O3 |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 4-(4-ethyl-3,3-dihydroxy-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl)-1-(4-fluorophenyl)butan-1-one |
| SMILES | CCN1c2cccc3c2N(CC1(O)O)C1CCN(CCCC(=O)c2ccc(F)cc2)CC31 |
| InChI | InChI=1S/C25H30FN3O3/c1-2-29-22-6-3-5-19-20-15-27(13-4-7-23(30)17-8-10-18(26)11-9-17)14-12-21(20)28(24(19)22)16-25(29,31)32/h3,5-6,8-11,20-21,31-32H,2,4,7,12-16H2,1H3 |
| InChIKey | JBBPVOSUTYTYCQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 67.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|