C33H35F2N3O2 — CID 175665310
1-(4-fluorophenyl)-4-[(10R,15S)-4-[4-(4-fluorophenyl)-4-oxobutyl]-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]butan-1-one (PubChem CID 175665310) has the molecular formula C33H35F2N3O2 and a molecular weight of 543.66 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-[(10R,15S)-4-[4-(4-fluorophenyl)-4-oxobutyl]-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]butan-1-one.
| Compound Name | 1-(4-fluorophenyl)-4-[(10R,15S)-4-[4-(4-fluorophenyl)-4-oxobutyl]-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]butan-1-one |
|---|---|
| PubChem CID | 175665310 |
| Molecular Formula | C33H35F2N3O2 |
| Molecular Weight | 543.66 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | 1-(4-fluorophenyl)-4-[(10R,15S)-4-[4-(4-fluorophenyl)-4-oxobutyl]-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]butan-1-one |
| SMILES | O=C(CCCN1CC[C@H]2[C@@H](C1)c1cccc3c1N2CCN3CCCC(=O)c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C33H35F2N3O2/c34-25-12-8-23(9-13-25)31(39)6-2-17-36-19-16-29-28(22-36)27-4-1-5-30-33(27)38(29)21-20-37(30)18-3-7-32(40)24-10-14-26(35)15-11-24/h1,4-5,8-15,28-29H,2-3,6-7,16-22H2/t28-,29-/m0/s1 |
| InChIKey | OIRAMDYQDMWOND-VMPREFPWSA-N |
| XLogP | 6.09 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.66 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |