C33H42FN3O5 — CID 118697640
octanoyloxymethyl (10R,15S)-12-[4-(4-fluorophenyl)-4-oxobutyl]-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-4-carboxylate (PubChem CID 118697640) has the molecular formula C33H42FN3O5 and a molecular weight of 579.71 g/mol. Its IUPAC name is octanoyloxymethyl (10R,15S)-12-[4-(4-fluorophenyl)-4-oxobutyl]-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-4-carboxylate.
| Compound Name | octanoyloxymethyl (10R,15S)-12-[4-(4-fluorophenyl)-4-oxobutyl]-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-4-carboxylate |
|---|---|
| PubChem CID | 118697640 |
| Molecular Formula | C33H42FN3O5 |
| Molecular Weight | 579.71 g/mol |
| Exact Mass | 579.31 |
| IUPAC Name | octanoyloxymethyl (10R,15S)-12-[4-(4-fluorophenyl)-4-oxobutyl]-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-4-carboxylate |
| SMILES | CCCCCCCC(=O)OCOC(=O)N1CCN2c3c(cccc31)[C@@H]1CN(CCCC(=O)c3ccc(F)cc3)CC[C@@H]12 |
| InChI | InChI=1S/C33H42FN3O5/c1-2-3-4-5-6-12-31(39)41-23-42-33(40)37-21-20-36-28-17-19-35(22-27(28)26-9-7-10-29(37)32(26)36)18-8-11-30(38)24-13-15-25(34)16-14-24/h7,9-10,13-16,27-28H,2-6,8,11-12,17-23H2,1H3/t27-,28-/m0/s1 |
| InChIKey | OVXJNPAFWUTCBT-NSOVKSMOSA-N |
| XLogP | 6.28 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.71 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|