C34H46N3O5P — CID 170320138
1-octanoyloxyethyl (10R,15S)-12-[4-oxo-4-(4-phosphanylphenyl)butyl]-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-4-carboxylate (PubChem CID 170320138) has the molecular formula C34H46N3O5P and a molecular weight of 607.73 g/mol. Its IUPAC name is 1-octanoyloxyethyl (10R,15S)-12-[4-oxo-4-(4-phosphanylphenyl)butyl]-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-4-carboxylate.
| Compound Name | 1-octanoyloxyethyl (10R,15S)-12-[4-oxo-4-(4-phosphanylphenyl)butyl]-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-4-carboxylate |
|---|---|
| PubChem CID | 170320138 |
| Molecular Formula | C34H46N3O5P |
| Molecular Weight | 607.73 g/mol |
| Exact Mass | 607.32 |
| IUPAC Name | 1-octanoyloxyethyl (10R,15S)-12-[4-oxo-4-(4-phosphanylphenyl)butyl]-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-4-carboxylate |
| SMILES | CCCCCCCC(=O)OC(C)OC(=O)N1CCN2c3c(cccc31)[C@@H]1CN(CCCC(=O)c3ccc(P)cc3)CC[C@@H]12 |
| InChI | InChI=1S/C34H46N3O5P/c1-3-4-5-6-7-13-32(39)41-24(2)42-34(40)37-22-21-36-29-18-20-35(23-28(29)27-10-8-11-30(37)33(27)36)19-9-12-31(38)25-14-16-26(43)17-15-25/h8,10-11,14-17,24,28-29H,3-7,9,12-13,18-23,43H2,1-2H3/t24?,28-,29-/m0/s1 |
| InChIKey | AEFDFPNFZSRGRI-UTARDKEYSA-N |
| XLogP | 6.03 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.73 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|