C25H31N3O — CID 161270909
1-(4-methylphenyl)-4-(2,2,3,3-tetradeuterio-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl)butan-1-one (PubChem CID 161270909) has the molecular formula C25H31N3O and a molecular weight of 393.57 g/mol. Its IUPAC name is 1-(4-methylphenyl)-4-(2,2,3,3-tetradeuterio-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl)butan-1-one.
| Compound Name | 1-(4-methylphenyl)-4-(2,2,3,3-tetradeuterio-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl)butan-1-one |
|---|---|
| PubChem CID | 161270909 |
| Molecular Formula | C25H31N3O |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | 1-(4-methylphenyl)-4-(2,2,3,3-tetradeuterio-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl)butan-1-one |
| SMILES | [2H]C1([2H])N(C)c2cccc3c2N(C2CCN(CCCC(=O)c4ccc(C)cc4)CC32)C1([2H])[2H] |
| InChI | InChI=1S/C25H31N3O/c1-18-8-10-19(11-9-18)24(29)7-4-13-27-14-12-22-21(17-27)20-5-3-6-23-25(20)28(22)16-15-26(23)2/h3,5-6,8-11,21-22H,4,7,12-17H2,1-2H3/i15D2,16D2 |
| InChIKey | ZKGRDAVYSFBMGU-ONNKGWAKSA-N |
| XLogP | 4.09 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |