C31H37FN3O4S+ — CID 158539393
1-(4-fluorophenyl)-4-[(10R,15S)-2,2,3,3-tetradeuterio-4-methyl-1,4-diaza-12-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]butan-1-one;4-methylbenzenesulfonic acid (PubChem CID 158539393) has the molecular formula C31H37FN3O4S+ and a molecular weight of 570.74 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-[(10R,15S)-2,2,3,3-tetradeuterio-4-methyl-1,4-diaza-12-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]butan-1-one;4-methylbenzenesulfonic acid.
| Compound Name | 1-(4-fluorophenyl)-4-[(10R,15S)-2,2,3,3-tetradeuterio-4-methyl-1,4-diaza-12-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]butan-1-one;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 158539393 |
| Molecular Formula | C31H37FN3O4S+ |
| Molecular Weight | 570.74 g/mol |
| Exact Mass | 570.27 |
| IUPAC Name | 1-(4-fluorophenyl)-4-[(10R,15S)-2,2,3,3-tetradeuterio-4-methyl-1,4-diaza-12-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]butan-1-one;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.[2H]C1([2H])N(C)c2cccc3c2N([C@H]2CC[NH+](CCCC(=O)c4ccc(F)cc4)C[C@@H]32)C1([2H])[2H] |
| InChI | InChI=1S/C24H28FN3O.C7H8O3S/c1-26-14-15-28-21-11-13-27(16-20(21)19-4-2-5-22(26)24(19)28)12-3-6-23(29)17-7-9-18(25)10-8-17;1-6-2-4-7(5-3-6)11(8,9)10/h2,4-5,7-10,20-21H,3,6,11-16H2,1H3;2-5H,1H3,(H,8,9,10)/p+1/t20-,21-;/m0./s1/i14D2,15D2; |
| InChIKey | LHAPOGAFBLSJJQ-PYZJXVKESA-O |
| XLogP | 3.74 |
| TPSA | 82.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.74 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|