C28H29FN2OS — CID 76581895
1-(4-fluorophenyl)-4-[6-(4-methylphenyl)sulfanyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indol-2-yl]butan-1-one (PubChem CID 76581895) has the molecular formula C28H29FN2OS and a molecular weight of 460.62 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-[6-(4-methylphenyl)sulfanyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indol-2-yl]butan-1-one.
| Compound Name | 1-(4-fluorophenyl)-4-[6-(4-methylphenyl)sulfanyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indol-2-yl]butan-1-one |
|---|---|
| PubChem CID | 76581895 |
| Molecular Formula | C28H29FN2OS |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 1-(4-fluorophenyl)-4-[6-(4-methylphenyl)sulfanyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indol-2-yl]butan-1-one |
| SMILES | Cc1ccc(Sc2cccc3c2NC2CCN(CCCC(=O)c4ccc(F)cc4)CC32)cc1 |
| InChI | InChI=1S/C28H29FN2OS/c1-19-7-13-22(14-8-19)33-27-6-2-4-23-24-18-31(17-15-25(24)30-28(23)27)16-3-5-26(32)20-9-11-21(29)12-10-20/h2,4,6-14,24-25,30H,3,5,15-18H2,1H3 |
| InChIKey | GRSQXQAOGRCUPI-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |