C26H31FN2O — CID 178095517
4-[(10R,15S)-1,4-dimethyl-4,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]-1-(4-fluorophenyl)butan-1-one (PubChem CID 178095517) has the molecular formula C26H31FN2O and a molecular weight of 406.55 g/mol. Its IUPAC name is 4-[(10R,15S)-1,4-dimethyl-4,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]-1-(4-fluorophenyl)butan-1-one.
| Compound Name | 4-[(10R,15S)-1,4-dimethyl-4,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]-1-(4-fluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 178095517 |
| Molecular Formula | C26H31FN2O |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 4-[(10R,15S)-1,4-dimethyl-4,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]-1-(4-fluorophenyl)butan-1-one |
| SMILES | CN1CCC2(C)c3c(cccc31)[C@@H]1CN(CCCC(=O)c3ccc(F)cc3)CC[C@@H]12 |
| InChI | InChI=1S/C26H31FN2O/c1-26-13-16-28(2)23-6-3-5-20(25(23)26)21-17-29(15-12-22(21)26)14-4-7-24(30)18-8-10-19(27)11-9-18/h3,5-6,8-11,21-22H,4,7,12-17H2,1-2H3/t21-,22-,26?/m0/s1 |
| InChIKey | QYCJUVRPNZJOLL-PFXBLUCKSA-N |
| XLogP | 5.01 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |