C25H30FN3O — CID 123615300
4-(4,15-dimethyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl)-1-(4-fluorophenyl)butan-1-one (PubChem CID 123615300) has the molecular formula C25H30FN3O and a molecular weight of 407.53 g/mol. Its IUPAC name is 4-(4,15-dimethyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl)-1-(4-fluorophenyl)butan-1-one.
| Compound Name | 4-(4,15-dimethyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl)-1-(4-fluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 123615300 |
| Molecular Formula | C25H30FN3O |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | 4-(4,15-dimethyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl)-1-(4-fluorophenyl)butan-1-one |
| SMILES | CN1CCN2c3c(cccc31)C1CN(CCCC(=O)c3ccc(F)cc3)CCC12C |
| InChI | InChI=1S/C25H30FN3O/c1-25-12-14-28(13-4-7-23(30)18-8-10-19(26)11-9-18)17-21(25)20-5-3-6-22-24(20)29(25)16-15-27(22)2/h3,5-6,8-11,21H,4,7,12-17H2,1-2H3 |
| InChIKey | IECNHIWKAFRVDY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |