C24H28FN3O — CID 178095453
3-[(10R,15S)-4,15-dimethyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]-1-(4-fluorophenyl)propan-1-one (PubChem CID 178095453) has the molecular formula C24H28FN3O and a molecular weight of 393.51 g/mol. Its IUPAC name is 3-[(10R,15S)-4,15-dimethyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]-1-(4-fluorophenyl)propan-1-one.
| Compound Name | 3-[(10R,15S)-4,15-dimethyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]-1-(4-fluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 178095453 |
| Molecular Formula | C24H28FN3O |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 3-[(10R,15S)-4,15-dimethyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]-1-(4-fluorophenyl)propan-1-one |
| SMILES | CN1CCN2c3c(cccc31)[C@@H]1CN(CCC(=O)c3ccc(F)cc3)CC[C@@]12C |
| InChI | InChI=1S/C24H28FN3O/c1-24-11-13-27(12-10-22(29)17-6-8-18(25)9-7-17)16-20(24)19-4-3-5-21-23(19)28(24)15-14-26(21)2/h3-9,20H,10-16H2,1-2H3/t20-,24-/m0/s1 |
| InChIKey | KCSMIGYGXCKESP-RDPSFJRHSA-N |
| XLogP | 3.92 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |