C25H29N3O — CID 178095503
3-[2-[(10R,15S)-1,4-dimethyl-4,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]ethyl]-1,2-benzoxazole (PubChem CID 178095503) has the molecular formula C25H29N3O and a molecular weight of 387.53 g/mol. Its IUPAC name is 3-[2-[(10R,15S)-1,4-dimethyl-4,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]ethyl]-1,2-benzoxazole.
| Compound Name | 3-[2-[(10R,15S)-1,4-dimethyl-4,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]ethyl]-1,2-benzoxazole |
|---|---|
| PubChem CID | 178095503 |
| Molecular Formula | C25H29N3O |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 3-[2-[(10R,15S)-1,4-dimethyl-4,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]ethyl]-1,2-benzoxazole |
| SMILES | CN1CCC2(C)c3c(cccc31)[C@@H]1CN(CCc3noc4ccccc34)CC[C@@H]12 |
| InChI | InChI=1S/C25H29N3O/c1-25-12-15-27(2)22-8-5-7-17(24(22)25)19-16-28(13-10-20(19)25)14-11-21-18-6-3-4-9-23(18)29-26-21/h3-9,19-20H,10-16H2,1-2H3/t19-,20-,25?/m0/s1 |
| InChIKey | BFTILLLGEZKAES-QGGGIAGFSA-N |
| XLogP | 4.59 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |