C14H19N — CID 135040904
1-methyl-1,2,3,4,4a,9,9a,10-octahydroacridine (PubChem CID 135040904) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 1-methyl-1,2,3,4,4a,9,9a,10-octahydroacridine.
| Compound Name | 1-methyl-1,2,3,4,4a,9,9a,10-octahydroacridine |
|---|---|
| PubChem CID | 135040904 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 1-methyl-1,2,3,4,4a,9,9a,10-octahydroacridine |
| SMILES | CC1CCCC2Nc3ccccc3CC12 |
| InChI | InChI=1S/C14H19N/c1-10-5-4-8-14-12(10)9-11-6-2-3-7-13(11)15-14/h2-3,6-7,10,12,14-15H,4-5,8-9H2,1H3 |
| InChIKey | SQGQWJKTJKWFAY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |