C11H13N — CID 131872139
2-prop-1-enyl-2,3-dihydro-1H-indole (PubChem CID 131872139) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is 2-prop-1-enyl-2,3-dihydro-1H-indole.
| Compound Name | 2-prop-1-enyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 131872139 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 2-prop-1-enyl-2,3-dihydro-1H-indole |
| SMILES | CC=CC1Cc2ccccc2N1 |
| InChI | InChI=1S/C11H13N/c1-2-5-10-8-9-6-3-4-7-11(9)12-10/h2-7,10,12H,8H2,1H3 |
| InChIKey | YOWJEJJQJRCDKM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|