C10H13NO2 — CID 144722451
formic acid;2-methyl-2,3-dihydro-1H-indole (PubChem CID 144722451) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is formic acid;2-methyl-2,3-dihydro-1H-indole.
| Compound Name | formic acid;2-methyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 144722451 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | formic acid;2-methyl-2,3-dihydro-1H-indole |
| SMILES | CC1Cc2ccccc2N1.O=CO |
| InChI | InChI=1S/C9H11N.CH2O2/c1-7-6-8-4-2-3-5-9(8)10-7;2-1-3/h2-5,7,10H,6H2,1H3;1H,(H,2,3) |
| InChIKey | GSPVNPFPDAJTLG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|