C13H17N — CID 139325811
(2R,3S)-2-cyclopropyl-3-methyl-1,2,3,4-tetrahydroquinoline (PubChem CID 139325811) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is (2R,3S)-2-cyclopropyl-3-methyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | (2R,3S)-2-cyclopropyl-3-methyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 139325811 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (2R,3S)-2-cyclopropyl-3-methyl-1,2,3,4-tetrahydroquinoline |
| SMILES | C[C@H]1Cc2ccccc2N[C@H]1C1CC1 |
| InChI | InChI=1S/C13H17N/c1-9-8-11-4-2-3-5-12(11)14-13(9)10-6-7-10/h2-5,9-10,13-14H,6-8H2,1H3/t9-,13+/m0/s1 |
| InChIKey | HFDIAUXKVFLAJN-TVQRCGJNSA-N |
| XLogP | 3.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |