C11H16N2 — CID 83860499
1-(2,3-dihydro-1H-indol-2-yl)-N-methylethanamine (PubChem CID 83860499) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-indol-2-yl)-N-methylethanamine.
| Compound Name | 1-(2,3-dihydro-1H-indol-2-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 83860499 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 1-(2,3-dihydro-1H-indol-2-yl)-N-methylethanamine |
| SMILES | CNC(C)C1Cc2ccccc2N1 |
| InChI | InChI=1S/C11H16N2/c1-8(12-2)11-7-9-5-3-4-6-10(9)13-11/h3-6,8,11-13H,7H2,1-2H3 |
| InChIKey | VZMRZJOBFLSKGM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |