C12H17N — CID 70399536
2-butan-2-yl-2,3-dihydro-1H-indole (PubChem CID 70399536) has the molecular formula C12H17N and a molecular weight of 175.28 g/mol. Its IUPAC name is 2-butan-2-yl-2,3-dihydro-1H-indole.
| Compound Name | 2-butan-2-yl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 70399536 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 2-butan-2-yl-2,3-dihydro-1H-indole |
| SMILES | CCC(C)C1Cc2ccccc2N1 |
| InChI | InChI=1S/C12H17N/c1-3-9(2)12-8-10-6-4-5-7-11(10)13-12/h4-7,9,12-13H,3,8H2,1-2H3 |
| InChIKey | GXMJQYVOFUYXPN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |