C24H23NO2 — CID 143004699
methyl 4-[(1R,9S,10R)-8-azatetracyclo[8.7.0.02,7.014,17]heptadeca-2,4,6,14(17),15-pentaen-9-yl]benzoate (PubChem CID 143004699) has the molecular formula C24H23NO2 and a molecular weight of 357.45 g/mol. Its IUPAC name is methyl 4-[(1R,9S,10R)-8-azatetracyclo[8.7.0.02,7.014,17]heptadeca-2,4,6,14(17),15-pentaen-9-yl]benzoate.
| Compound Name | methyl 4-[(1R,9S,10R)-8-azatetracyclo[8.7.0.02,7.014,17]heptadeca-2,4,6,14(17),15-pentaen-9-yl]benzoate |
|---|---|
| PubChem CID | 143004699 |
| Molecular Formula | C24H23NO2 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | methyl 4-[(1R,9S,10R)-8-azatetracyclo[8.7.0.02,7.014,17]heptadeca-2,4,6,14(17),15-pentaen-9-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@H]2Nc3ccccc3[C@H]3C4=C(C=C4)CCC[C@@H]23)cc1 |
| InChI | InChI=1S/C24H23NO2/c1-27-24(26)17-11-9-16(10-12-17)23-20-7-4-5-15-13-14-18(15)22(20)19-6-2-3-8-21(19)25-23/h2-3,6,8-14,20,22-23,25H,4-5,7H2,1H3/t20-,22-,23-/m1/s1 |
| InChIKey | KBHDOPRJGPEQMI-YMPZKCBVSA-N |
| XLogP | 5.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |