C22H25F3N2O — CID 59803360
3-[[(2R,3aR,4R,9bS)-4-phenyl-8-(trifluoromethyl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-2-yl]amino]propan-1-ol (PubChem CID 59803360) has the molecular formula C22H25F3N2O and a molecular weight of 390.45 g/mol. Its IUPAC name is 3-[[(2R,3aR,4R,9bS)-4-phenyl-8-(trifluoromethyl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-2-yl]amino]propan-1-ol.
| Compound Name | 3-[[(2R,3aR,4R,9bS)-4-phenyl-8-(trifluoromethyl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-2-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 59803360 |
| Molecular Formula | C22H25F3N2O |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 3-[[(2R,3aR,4R,9bS)-4-phenyl-8-(trifluoromethyl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-2-yl]amino]propan-1-ol |
| SMILES | OCCCN[C@H]1C[C@@H]2[C@H](C1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C22H25F3N2O/c23-22(24,25)15-7-8-20-18(11-15)17-12-16(26-9-4-10-28)13-19(17)21(27-20)14-5-2-1-3-6-14/h1-3,5-8,11,16-17,19,21,26-28H,4,9-10,12-13H2/t16-,17-,19-,21+/m1/s1 |
| InChIKey | CYZMYYWUBBWZIY-ZJSJBZJDSA-N |
| XLogP | 4.71 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|