C19H19F3N2 — CID 143368480
(2S,4R,9bS)-4-phenyl-8-(trifluoromethyl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-2-amine (PubChem CID 143368480) has the molecular formula C19H19F3N2 and a molecular weight of 332.37 g/mol. Its IUPAC name is (2S,4R,9bS)-4-phenyl-8-(trifluoromethyl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-2-amine.
| Compound Name | (2S,4R,9bS)-4-phenyl-8-(trifluoromethyl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-2-amine |
|---|---|
| PubChem CID | 143368480 |
| Molecular Formula | C19H19F3N2 |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | (2S,4R,9bS)-4-phenyl-8-(trifluoromethyl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-2-amine |
| SMILES | N[C@@H]1CC2[C@H](C1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C19H19F3N2/c20-19(21,22)12-6-7-17-15(8-12)14-9-13(23)10-16(14)18(24-17)11-4-2-1-3-5-11/h1-8,13-14,16,18,24H,9-10,23H2/t13-,14+,16?,18-/m0/s1 |
| InChIKey | NRTIEGVLHJWVCC-RTDQLFBCSA-N |
| XLogP | 4.69 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |