C20H19F3N2O — CID 162600629
(E)-[(4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydropyrano[3,2-c]quinolin-2-ylidene]methanamine (PubChem CID 162600629) has the molecular formula C20H19F3N2O and a molecular weight of 360.38 g/mol. Its IUPAC name is (E)-[(4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydropyrano[3,2-c]quinolin-2-ylidene]methanamine.
| Compound Name | (E)-[(4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydropyrano[3,2-c]quinolin-2-ylidene]methanamine |
|---|---|
| PubChem CID | 162600629 |
| Molecular Formula | C20H19F3N2O |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | (E)-[(4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydropyrano[3,2-c]quinolin-2-ylidene]methanamine |
| SMILES | N/C=C1\CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C20H19F3N2O/c21-20(22,23)13-6-9-17-16(10-13)19-15(8-7-14(11-24)26-19)18(25-17)12-4-2-1-3-5-12/h1-6,9-11,15,18-19,25H,7-8,24H2/b14-11+/t15-,18-,19-/m0/s1 |
| InChIKey | QZIJFJZNEOCKOI-SJWDUZGXSA-N |
| XLogP | 5.14 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |