C14H17O6P — CID 102140449
methyl (1S,2S,3S)-1-dimethoxyphosphoryl-2-formyl-3-phenylcyclopropane-1-carboxylate (PubChem CID 102140449) has the molecular formula C14H17O6P and a molecular weight of 312.26 g/mol. Its IUPAC name is methyl (1S,2S,3S)-1-dimethoxyphosphoryl-2-formyl-3-phenylcyclopropane-1-carboxylate.
| Compound Name | methyl (1S,2S,3S)-1-dimethoxyphosphoryl-2-formyl-3-phenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 102140449 |
| Molecular Formula | C14H17O6P |
| Molecular Weight | 312.26 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | methyl (1S,2S,3S)-1-dimethoxyphosphoryl-2-formyl-3-phenylcyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@@]1(P(=O)(OC)OC)[C@H](C=O)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C14H17O6P/c1-18-13(16)14(21(17,19-2)20-3)11(9-15)12(14)10-7-5-4-6-8-10/h4-9,11-12H,1-3H3/t11-,12-,14-/m1/s1 |
| InChIKey | DSWUACHPECGVCD-YRGRVCCFSA-N |
| XLogP | 2.00 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|