C16H16ClNO4 — CID 102297519
methyl (1S,2R,3R,6R)-2-(3-chlorophenyl)-1-cyano-3-formyl-6-hydroxycyclohexane-1-carboxylate (PubChem CID 102297519) has the molecular formula C16H16ClNO4 and a molecular weight of 321.76 g/mol. Its IUPAC name is methyl (1S,2R,3R,6R)-2-(3-chlorophenyl)-1-cyano-3-formyl-6-hydroxycyclohexane-1-carboxylate.
| Compound Name | methyl (1S,2R,3R,6R)-2-(3-chlorophenyl)-1-cyano-3-formyl-6-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 102297519 |
| Molecular Formula | C16H16ClNO4 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | methyl (1S,2R,3R,6R)-2-(3-chlorophenyl)-1-cyano-3-formyl-6-hydroxycyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@@]1(C#N)[C@H](O)CC[C@@H](C=O)[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H16ClNO4/c1-22-15(21)16(9-18)13(20)6-5-11(8-19)14(16)10-3-2-4-12(17)7-10/h2-4,7-8,11,13-14,20H,5-6H2,1H3/t11-,13+,14-,16-/m0/s1 |
| InChIKey | MYEPIROSCHMYMQ-AEIGPULVSA-N |
| XLogP | 2.08 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|