C15H8ClN5 — CID 95166564
(1R,2S,3R)-1-(1-amino-2,2-dicyanoethenyl)-3-(3-chlorophenyl)cyclopropane-1,2-dicarbonitrile (PubChem CID 95166564) has the molecular formula C15H8ClN5 and a molecular weight of 293.72 g/mol. Its IUPAC name is (1R,2S,3R)-1-(1-amino-2,2-dicyanoethenyl)-3-(3-chlorophenyl)cyclopropane-1,2-dicarbonitrile.
| Compound Name | (1R,2S,3R)-1-(1-amino-2,2-dicyanoethenyl)-3-(3-chlorophenyl)cyclopropane-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 95166564 |
| Molecular Formula | C15H8ClN5 |
| Molecular Weight | 293.72 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | (1R,2S,3R)-1-(1-amino-2,2-dicyanoethenyl)-3-(3-chlorophenyl)cyclopropane-1,2-dicarbonitrile |
| SMILES | N#CC(C#N)=C(N)[C@]1(C#N)[C@@H](C#N)[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H8ClN5/c16-11-3-1-2-9(4-11)13-12(7-19)15(13,8-20)14(21)10(5-17)6-18/h1-4,12-13H,21H2/t12-,13-,15+/m0/s1 |
| InChIKey | PINIDGPABYMYMH-KCQAQPDRSA-N |
| XLogP | 2.35 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.72 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|