C11H11ClN2 — CID 131579141
1-amino-3-(3-chlorophenyl)cyclobutane-1-carbonitrile (PubChem CID 131579141) has the molecular formula C11H11ClN2 and a molecular weight of 206.68 g/mol. Its IUPAC name is 1-amino-3-(3-chlorophenyl)cyclobutane-1-carbonitrile.
| Compound Name | 1-amino-3-(3-chlorophenyl)cyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 131579141 |
| Molecular Formula | C11H11ClN2 |
| Molecular Weight | 206.68 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 1-amino-3-(3-chlorophenyl)cyclobutane-1-carbonitrile |
| SMILES | N#CC1(N)CC(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C11H11ClN2/c12-10-3-1-2-8(4-10)9-5-11(14,6-9)7-13/h1-4,9H,5-6,14H2 |
| InChIKey | QZKURXVETBQCJY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.68 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |