C12H14ClN3O2S — CID 66817154
4-amino-1-(3-chlorophenyl)sulfonylpiperidine-4-carbonitrile (PubChem CID 66817154) has the molecular formula C12H14ClN3O2S and a molecular weight of 299.78 g/mol. Its IUPAC name is 4-amino-1-(3-chlorophenyl)sulfonylpiperidine-4-carbonitrile.
| Compound Name | 4-amino-1-(3-chlorophenyl)sulfonylpiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 66817154 |
| Molecular Formula | C12H14ClN3O2S |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 4-amino-1-(3-chlorophenyl)sulfonylpiperidine-4-carbonitrile |
| SMILES | N#CC1(N)CCN(S(=O)(=O)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C12H14ClN3O2S/c13-10-2-1-3-11(8-10)19(17,18)16-6-4-12(15,9-14)5-7-16/h1-3,8H,4-7,15H2 |
| InChIKey | WIHRQHOYVXTBQC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |