C15H14ClN — CID 10847853
(1S,2R,3S,4R)-3-(3-chlorophenyl)bicyclo[2.2.2]oct-5-ene-2-carbonitrile (PubChem CID 10847853) has the molecular formula C15H14ClN and a molecular weight of 243.74 g/mol. Its IUPAC name is (1S,2R,3S,4R)-3-(3-chlorophenyl)bicyclo[2.2.2]oct-5-ene-2-carbonitrile.
| Compound Name | (1S,2R,3S,4R)-3-(3-chlorophenyl)bicyclo[2.2.2]oct-5-ene-2-carbonitrile |
|---|---|
| PubChem CID | 10847853 |
| Molecular Formula | C15H14ClN |
| Molecular Weight | 243.74 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | (1S,2R,3S,4R)-3-(3-chlorophenyl)bicyclo[2.2.2]oct-5-ene-2-carbonitrile |
| SMILES | N#C[C@H]1[C@@H](c2cccc(Cl)c2)[C@H]2C=C[C@@H]1CC2 |
| InChI | InChI=1S/C15H14ClN/c16-13-3-1-2-12(8-13)15-11-6-4-10(5-7-11)14(15)9-17/h1-4,6,8,10-11,14-15H,5,7H2/t10-,11+,14-,15-/m1/s1 |
| InChIKey | ABJGRTAPTFSOIH-BAESOJJISA-N |
| XLogP | 4.16 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.74 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|