C12H13Cl — CID 54091231
1-chloro-3-[(1R,2S)-2-cyclopropylcyclopropyl]benzene (PubChem CID 54091231) has the molecular formula C12H13Cl and a molecular weight of 192.69 g/mol. Its IUPAC name is 1-chloro-3-[(1R,2S)-2-cyclopropylcyclopropyl]benzene.
| Compound Name | 1-chloro-3-[(1R,2S)-2-cyclopropylcyclopropyl]benzene |
|---|---|
| PubChem CID | 54091231 |
| Molecular Formula | C12H13Cl |
| Molecular Weight | 192.69 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 1-chloro-3-[(1R,2S)-2-cyclopropylcyclopropyl]benzene |
| SMILES | Clc1cccc([C@@H]2C[C@H]2C2CC2)c1 |
| InChI | InChI=1S/C12H13Cl/c13-10-3-1-2-9(6-10)12-7-11(12)8-4-5-8/h1-3,6,8,11-12H,4-5,7H2/t11-,12-/m0/s1 |
| InChIKey | IIWPBYFFMIYLKS-RYUDHWBXSA-N |
| XLogP | 3.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.69 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |