C10H10ClF3O3S — CID 87246766
1-chloro-3-cyclopropylbenzene;trifluoromethanesulfonic acid (PubChem CID 87246766) has the molecular formula C10H10ClF3O3S and a molecular weight of 302.70 g/mol. Its IUPAC name is 1-chloro-3-cyclopropylbenzene;trifluoromethanesulfonic acid.
| Compound Name | 1-chloro-3-cyclopropylbenzene;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 87246766 |
| Molecular Formula | C10H10ClF3O3S |
| Molecular Weight | 302.70 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | 1-chloro-3-cyclopropylbenzene;trifluoromethanesulfonic acid |
| SMILES | Clc1cccc(C2CC2)c1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C9H9Cl.CHF3O3S/c10-9-3-1-2-8(6-9)7-4-5-7;2-1(3,4)8(5,6)7/h1-3,6-7H,4-5H2;(H,5,6,7) |
| InChIKey | YDYCLNNLKWYLOZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.70 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|