About 1-chloro-3-cyclopropylbenzene;trifluoromethanesulfonic acid
1-chloro-3-cyclopropylbenzene;trifluoromethanesulfonic acid (PubChem CID 87246766) has the molecular formula C10H10ClF3O3S
and a molecular weight of 302.70 g/mol. Its IUPAC name is 1-chloro-3-cyclopropylbenzene;trifluoromethanesulfonic acid.
Molecular Properties
| Compound Name | 1-chloro-3-cyclopropylbenzene;trifluoromethanesulfonic acid |
| PubChem CID | 87246766 |
| Molecular Formula | C10H10ClF3O3S |
| Molecular Weight | 302.70 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | 1-chloro-3-cyclopropylbenzene;trifluoromethanesulfonic acid |
| SMILES | Clc1cccc(C2CC2)c1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C9H9Cl.CHF3O3S/c10-9-3-1-2-8(6-9)7-4-5-7;2-1(3,4)8(5,6)7/h1-3,6-7H,4-5H2;(H,5,6,7) |
| InChIKey | YDYCLNNLKWYLOZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.70 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-3-cyclopropylbenzene;trifluoromethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-cyclopropylbenzene;trifluoromethanesulfonic acid?
The IUPAC name of 1-chloro-3-cyclopropylbenzene;trifluoromethanesulfonic acid (CID 87246766) is 1-chloro-3-cyclopropylbenzene;trifluoromethanesulfonic acid.
What is the SMILES notation for 1-chloro-3-cyclopropylbenzene;trifluoromethanesulfonic acid?
The canonical SMILES for 1-chloro-3-cyclopropylbenzene;trifluoromethanesulfonic acid is Clc1cccc(C2CC2)c1.O=S(=O)(O)C(F)(F)F.
What is the InChIKey of 1-chloro-3-cyclopropylbenzene;trifluoromethanesulfonic acid?
The InChIKey is YDYCLNNLKWYLOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9Cl.CHF3O3S/c10-9-3-1-2-8(6-9)7-4-5-7;2-1(3,4)8(5,6)7/h1-3,6-7H,4-5H2;(H,5,6,7).
What are the key properties of 1-chloro-3-cyclopropylbenzene;trifluoromethanesulfonic acid?
1-chloro-3-cyclopropylbenzene;trifluoromethanesulfonic acid has a molecular weight of 302.70 g/mol, XLogP of 3.61, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-cyclopropylbenzene;trifluoromethanesulfonic acid is sourced from PubChem (CID 87246766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).