C25H32F3O3PS — CID 171927734
bis(4-cyclohexylphenyl)phosphane;trifluoromethanesulfonic acid (PubChem CID 171927734) has the molecular formula C25H32F3O3PS and a molecular weight of 500.56 g/mol. Its IUPAC name is bis(4-cyclohexylphenyl)phosphane;trifluoromethanesulfonic acid.
| Compound Name | bis(4-cyclohexylphenyl)phosphane;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 171927734 |
| Molecular Formula | C25H32F3O3PS |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | bis(4-cyclohexylphenyl)phosphane;trifluoromethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)F.c1cc(C2CCCCC2)ccc1Pc1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C24H31P.CHF3O3S/c1-3-7-19(8-4-1)21-11-15-23(16-12-21)25-24-17-13-22(14-18-24)20-9-5-2-6-10-20;2-1(3,4)8(5,6)7/h11-20,25H,1-10H2;(H,5,6,7) |
| InChIKey | ZQKXJGLHLXJIHY-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|