C14H16F4 — CID 23236608
1-cyclohexyl-4-(1,1,2,2-tetrafluoroethyl)benzene (PubChem CID 23236608) has the molecular formula C14H16F4 and a molecular weight of 260.27 g/mol. Its IUPAC name is 1-cyclohexyl-4-(1,1,2,2-tetrafluoroethyl)benzene.
| Compound Name | 1-cyclohexyl-4-(1,1,2,2-tetrafluoroethyl)benzene |
|---|---|
| PubChem CID | 23236608 |
| Molecular Formula | C14H16F4 |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 1-cyclohexyl-4-(1,1,2,2-tetrafluoroethyl)benzene |
| SMILES | FC(F)C(F)(F)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C14H16F4/c15-13(16)14(17,18)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h6-10,13H,1-5H2 |
| InChIKey | SURVAIGBBIYAHJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|