C15H19F4N — CID 79660160
1-(4-cyclohexylphenyl)-2,2,3,3-tetrafluoropropan-1-amine (PubChem CID 79660160) has the molecular formula C15H19F4N and a molecular weight of 289.32 g/mol. Its IUPAC name is 1-(4-cyclohexylphenyl)-2,2,3,3-tetrafluoropropan-1-amine.
| Compound Name | 1-(4-cyclohexylphenyl)-2,2,3,3-tetrafluoropropan-1-amine |
|---|---|
| PubChem CID | 79660160 |
| Molecular Formula | C15H19F4N |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 1-(4-cyclohexylphenyl)-2,2,3,3-tetrafluoropropan-1-amine |
| SMILES | NC(c1ccc(C2CCCCC2)cc1)C(F)(F)C(F)F |
| InChI | InChI=1S/C15H19F4N/c16-14(17)15(18,19)13(20)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h6-10,13-14H,1-5,20H2 |
| InChIKey | IDTHGWWFMZCETO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|