C14H22N2 — CID 66517695
(1R)-1-(4-cyclohexylphenyl)ethane-1,2-diamine (PubChem CID 66517695) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is (1R)-1-(4-cyclohexylphenyl)ethane-1,2-diamine.
| Compound Name | (1R)-1-(4-cyclohexylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 66517695 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | (1R)-1-(4-cyclohexylphenyl)ethane-1,2-diamine |
| SMILES | NC[C@H](N)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C14H22N2/c15-10-14(16)13-8-6-12(7-9-13)11-4-2-1-3-5-11/h6-9,11,14H,1-5,10,15-16H2/t14-/m0/s1 |
| InChIKey | ILXCCKWOTSLTGQ-AWEZNQCLSA-N |
| XLogP | 2.69 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |