C17H28N2 — CID 116934155
1-(4-cyclohexylphenyl)-3-methylbutane-1,4-diamine (PubChem CID 116934155) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is 1-(4-cyclohexylphenyl)-3-methylbutane-1,4-diamine.
| Compound Name | 1-(4-cyclohexylphenyl)-3-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 116934155 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 1-(4-cyclohexylphenyl)-3-methylbutane-1,4-diamine |
| SMILES | CC(CN)CC(N)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C17H28N2/c1-13(12-18)11-17(19)16-9-7-15(8-10-16)14-5-3-2-4-6-14/h7-10,13-14,17H,2-6,11-12,18-19H2,1H3 |
| InChIKey | VEQQTVRFOPUVNH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |