C12H17KNO2S — CID 67861960
CID 67861960 (PubChem CID 67861960) has the molecular formula C12H17KNO2S and a molecular weight of 278.44 g/mol.
| Compound Name | CID 67861960 |
|---|---|
| PubChem CID | 67861960 |
| Molecular Formula | C12H17KNO2S |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | — |
| SMILES | NS(=O)(=O)c1ccc(C2CCCCC2)cc1.[K] |
| InChI | InChI=1S/C12H17NO2S.K/c13-16(14,15)12-8-6-11(7-9-12)10-4-2-1-3-5-10;/h6-10H,1-5H2,(H2,13,14,15); |
| InChIKey | VNDBNROBFQXWQQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |