C18H21ClO4S — CID 88840608
benzenesulfonic acid;4-(3-chlorophenyl)cyclohexan-1-ol (PubChem CID 88840608) has the molecular formula C18H21ClO4S and a molecular weight of 368.88 g/mol. Its IUPAC name is benzenesulfonic acid;4-(3-chlorophenyl)cyclohexan-1-ol.
| Compound Name | benzenesulfonic acid;4-(3-chlorophenyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 88840608 |
| Molecular Formula | C18H21ClO4S |
| Molecular Weight | 368.88 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | benzenesulfonic acid;4-(3-chlorophenyl)cyclohexan-1-ol |
| SMILES | O=S(=O)(O)c1ccccc1.OC1CCC(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C12H15ClO.C6H6O3S/c13-11-3-1-2-10(8-11)9-4-6-12(14)7-5-9;7-10(8,9)6-4-2-1-3-5-6/h1-3,8-9,12,14H,4-7H2;1-5H,(H,7,8,9) |
| InChIKey | KDWDFOOAXSJPPP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.88 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|