C15H14ClN4O2+ — CID 7319551
(1S,5R,6R)-2-amino-6-(3-chlorophenyl)-4,4-dimethoxy-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile (PubChem CID 7319551) has the molecular formula C15H14ClN4O2+ and a molecular weight of 317.76 g/mol. Its IUPAC name is (1S,5R,6R)-2-amino-6-(3-chlorophenyl)-4,4-dimethoxy-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile.
| Compound Name | (1S,5R,6R)-2-amino-6-(3-chlorophenyl)-4,4-dimethoxy-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 7319551 |
| Molecular Formula | C15H14ClN4O2+ |
| Molecular Weight | 317.76 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | (1S,5R,6R)-2-amino-6-(3-chlorophenyl)-4,4-dimethoxy-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
| SMILES | COC1(OC)[NH+]=C(N)[C@@]2(C#N)[C@@H](c3cccc(Cl)c3)[C@@]12C#N |
| InChI | InChI=1S/C15H13ClN4O2/c1-21-15(22-2)14(8-18)11(9-4-3-5-10(16)6-9)13(14,7-17)12(19)20-15/h3-6,11H,1-2H3,(H2,19,20)/p+1/t11-,13-,14-/m1/s1 |
| InChIKey | VOUJMRQCSXITDO-MRVWCRGKSA-O |
| XLogP | -0.14 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.76 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|