C24H25N4O3+ — CID 7982442
(1S,5R,6S)-2-amino-4,4-diethoxy-6-(3-phenylmethoxyphenyl)-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile (PubChem CID 7982442) has the molecular formula C24H25N4O3+ and a molecular weight of 417.49 g/mol. Its IUPAC name is (1S,5R,6S)-2-amino-4,4-diethoxy-6-(3-phenylmethoxyphenyl)-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile.
| Compound Name | (1S,5R,6S)-2-amino-4,4-diethoxy-6-(3-phenylmethoxyphenyl)-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 7982442 |
| Molecular Formula | C24H25N4O3+ |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | (1S,5R,6S)-2-amino-4,4-diethoxy-6-(3-phenylmethoxyphenyl)-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
| SMILES | CCOC1(OCC)[NH+]=C(N)[C@@]2(C#N)[C@H](c3cccc(OCc4ccccc4)c3)[C@@]12C#N |
| InChI | InChI=1S/C24H24N4O3/c1-3-30-24(31-4-2)23(16-26)20(22(23,15-25)21(27)28-24)18-11-8-12-19(13-18)29-14-17-9-6-5-7-10-17/h5-13,20H,3-4,14H2,1-2H3,(H2,27,28)/p+1/t20-,22+,23+/m0/s1 |
| InChIKey | XEDCGULLIWRHRD-MDNUFGMLSA-O |
| XLogP | 1.56 |
| TPSA | 115.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|