C18H20N4OS2 — CID 3359957
2-amino-4,4-bis(ethylsulfanyl)-6-(3-methoxyphenyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile (PubChem CID 3359957) has the molecular formula C18H20N4OS2 and a molecular weight of 372.52 g/mol. Its IUPAC name is 2-amino-4,4-bis(ethylsulfanyl)-6-(3-methoxyphenyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile.
| Compound Name | 2-amino-4,4-bis(ethylsulfanyl)-6-(3-methoxyphenyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 3359957 |
| Molecular Formula | C18H20N4OS2 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 2-amino-4,4-bis(ethylsulfanyl)-6-(3-methoxyphenyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
| SMILES | CCSC1(SCC)N=C(N)C2(C#N)C(c3cccc(OC)c3)C12C#N |
| InChI | InChI=1S/C18H20N4OS2/c1-4-24-18(25-5-2)17(11-20)14(16(17,10-19)15(21)22-18)12-7-6-8-13(9-12)23-3/h6-9,14H,4-5H2,1-3H3,(H2,21,22) |
| InChIKey | HMIJRXKBVDPECK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 95.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|