C22H28N4S2 — CID 3365833
2-amino-4,4-bis(butylsulfanyl)-6-(4-methylphenyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile (PubChem CID 3365833) has the molecular formula C22H28N4S2 and a molecular weight of 412.63 g/mol. Its IUPAC name is 2-amino-4,4-bis(butylsulfanyl)-6-(4-methylphenyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile.
| Compound Name | 2-amino-4,4-bis(butylsulfanyl)-6-(4-methylphenyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 3365833 |
| Molecular Formula | C22H28N4S2 |
| Molecular Weight | 412.63 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 2-amino-4,4-bis(butylsulfanyl)-6-(4-methylphenyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
| SMILES | CCCCSC1(SCCCC)N=C(N)C2(C#N)C(c3ccc(C)cc3)C12C#N |
| InChI | InChI=1S/C22H28N4S2/c1-4-6-12-27-22(28-13-7-5-2)21(15-24)18(17-10-8-16(3)9-11-17)20(21,14-23)19(25)26-22/h8-11,18H,4-7,12-13H2,1-3H3,(H2,25,26) |
| InChIKey | KOTRXPQAMIALRN-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 85.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.63 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|