C24H32N4O3S2 — CID 3384478
2-amino-4,4-bis(butylsulfanyl)-6-(2,4,6-trimethoxyphenyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile (PubChem CID 3384478) has the molecular formula C24H32N4O3S2 and a molecular weight of 488.68 g/mol. Its IUPAC name is 2-amino-4,4-bis(butylsulfanyl)-6-(2,4,6-trimethoxyphenyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile.
| Compound Name | 2-amino-4,4-bis(butylsulfanyl)-6-(2,4,6-trimethoxyphenyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 3384478 |
| Molecular Formula | C24H32N4O3S2 |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | 2-amino-4,4-bis(butylsulfanyl)-6-(2,4,6-trimethoxyphenyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
| SMILES | CCCCSC1(SCCCC)N=C(N)C2(C#N)C(c3c(OC)cc(OC)cc3OC)C12C#N |
| InChI | InChI=1S/C24H32N4O3S2/c1-6-8-10-32-24(33-11-9-7-2)23(15-26)20(22(23,14-25)21(27)28-24)19-17(30-4)12-16(29-3)13-18(19)31-5/h12-13,20H,6-11H2,1-5H3,(H2,27,28) |
| InChIKey | DYVVSOJSCZHYCS-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|